C14H20ClNO2S — CID 171185965
(4S)-4-(2-tert-butylsulfanylphenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171185965) has the molecular formula C14H20ClNO2S and a molecular weight of 301.84 g/mol. Its IUPAC name is (4S)-4-(2-tert-butylsulfanylphenyl)-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4S)-4-(2-tert-butylsulfanylphenyl)-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171185965 |
| Molecular Formula | C14H20ClNO2S |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (4S)-4-(2-tert-butylsulfanylphenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | CC(C)(C)Sc1ccccc1[C@@H]1CCOC(=O)N1.Cl |
| InChI | InChI=1S/C14H19NO2S.ClH/c1-14(2,3)18-12-7-5-4-6-10(12)11-8-9-17-13(16)15-11;/h4-7,11H,8-9H2,1-3H3,(H,15,16);1H/t11-;/m0./s1 |
| InChIKey | ROQWOSVKXKDOHG-MERQFXBCSA-N |
| XLogP | 4.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |