C10H11ClN2O4 — CID 171184830
(4R)-4-(2-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171184830) has the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. Its IUPAC name is (4R)-4-(2-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4R)-4-(2-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171184830 |
| Molecular Formula | C10H11ClN2O4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | (4R)-4-(2-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@@H](c2ccccc2[N+](=O)[O-])CCO1 |
| InChI | InChI=1S/C10H10N2O4.ClH/c13-10-11-8(5-6-16-10)7-3-1-2-4-9(7)12(14)15;/h1-4,8H,5-6H2,(H,11,13);1H/t8-;/m1./s1 |
| InChIKey | AOKSVINBWZGOMQ-DDWIOCJRSA-N |
| XLogP | 2.19 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|