C12H15ClN2O6 — CID 171185934
(4S)-4-(4,5-dimethoxy-2-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171185934) has the molecular formula C12H15ClN2O6 and a molecular weight of 318.71 g/mol. Its IUPAC name is (4S)-4-(4,5-dimethoxy-2-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4S)-4-(4,5-dimethoxy-2-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171185934 |
| Molecular Formula | C12H15ClN2O6 |
| Molecular Weight | 318.71 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (4S)-4-(4,5-dimethoxy-2-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | COc1cc([C@@H]2CCOC(=O)N2)c([N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C12H14N2O6.ClH/c1-18-10-5-7(8-3-4-20-12(15)13-8)9(14(16)17)6-11(10)19-2;/h5-6,8H,3-4H2,1-2H3,(H,13,15);1H/t8-;/m0./s1 |
| InChIKey | YADCNBRRPOEZRH-QRPNPIFTSA-N |
| XLogP | 2.20 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.71 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|