About (4R)-4-(2-chloro-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride
(4R)-4-(2-chloro-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171185134) has the molecular formula C10H10Cl2N2O4
and a molecular weight of 293.11 g/mol. Its IUPAC name is (4R)-4-(2-chloro-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride.
Molecular Properties
| Compound Name | (4R)-4-(2-chloro-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride |
| PubChem CID | 171185134 |
| Molecular Formula | C10H10Cl2N2O4 |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | (4R)-4-(2-chloro-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@@H](c2cc([N+](=O)[O-])ccc2Cl)CCO1 |
| InChI | InChI=1S/C10H9ClN2O4.ClH/c11-8-2-1-6(13(15)16)5-7(8)9-3-4-17-10(14)12-9;/h1-2,5,9H,3-4H2,(H,12,14);1H/t9-;/m1./s1 |
| InChIKey | CKLZUJKUESHLBA-SBSPUUFOSA-N |
| XLogP | 2.84 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-(2-chloro-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(2-chloro-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride?
The IUPAC name of (4R)-4-(2-chloro-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride (CID 171185134) is (4R)-4-(2-chloro-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride.
What is the SMILES notation for (4R)-4-(2-chloro-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride?
The canonical SMILES for (4R)-4-(2-chloro-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride is Cl.O=C1N[C@@H](c2cc([N+](=O)[O-])ccc2Cl)CCO1.
What is the InChIKey of (4R)-4-(2-chloro-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride?
The InChIKey is CKLZUJKUESHLBA-SBSPUUFOSA-N. The full InChI is InChI=1S/C10H9ClN2O4.ClH/c11-8-2-1-6(13(15)16)5-7(8)9-3-4-17-10(14)12-9;/h1-2,5,9H,3-4H2,(H,12,14);1H/t9-;/m1./s1.
What are the key properties of (4R)-4-(2-chloro-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride?
(4R)-4-(2-chloro-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride has a molecular weight of 293.11 g/mol, XLogP of 2.84, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(2-chloro-5-nitrophenyl)-1,3-oxazinan-2-one;hydrochloride is sourced from PubChem (CID 171185134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).