C10H9Cl2NO2 — CID 171184906
(4R)-4-(3,4-dichlorophenyl)-1,3-oxazinan-2-one (PubChem CID 171184906) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is (4R)-4-(3,4-dichlorophenyl)-1,3-oxazinan-2-one.
| Compound Name | (4R)-4-(3,4-dichlorophenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171184906 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | (4R)-4-(3,4-dichlorophenyl)-1,3-oxazinan-2-one |
| SMILES | O=C1N[C@@H](c2ccc(Cl)c(Cl)c2)CCO1 |
| InChI | InChI=1S/C10H9Cl2NO2/c11-7-2-1-6(5-8(7)12)9-3-4-15-10(14)13-9/h1-2,5,9H,3-4H2,(H,13,14)/t9-/m1/s1 |
| InChIKey | DNTDTJJEVVYBAZ-SECBINFHSA-N |
| XLogP | 3.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |