C14H14ClNO2 — CID 171185570
(4S)-4-naphthalen-2-yl-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171185570) has the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. Its IUPAC name is (4S)-4-naphthalen-2-yl-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4S)-4-naphthalen-2-yl-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171185570 |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | (4S)-4-naphthalen-2-yl-1,3-oxazinan-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@H](c2ccc3ccccc3c2)CCO1 |
| InChI | InChI=1S/C14H13NO2.ClH/c16-14-15-13(7-8-17-14)12-6-5-10-3-1-2-4-11(10)9-12;/h1-6,9,13H,7-8H2,(H,15,16);1H/t13-;/m0./s1 |
| InChIKey | VMOWFBJNJZNZLH-ZOWNYOTGSA-N |
| XLogP | 3.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |