About 3-naphthalen-2-yl-1,2-oxazolidine
3-naphthalen-2-yl-1,2-oxazolidine (PubChem CID 164533749) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-naphthalen-2-yl-1,2-oxazolidine.
Molecular Properties
| Compound Name | 3-naphthalen-2-yl-1,2-oxazolidine |
| PubChem CID | 164533749 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 3-naphthalen-2-yl-1,2-oxazolidine |
| SMILES | c1ccc2cc(C3CCON3)ccc2c1 |
| InChI | InChI=1S/C13H13NO/c1-2-4-11-9-12(6-5-10(11)3-1)13-7-8-15-14-13/h1-6,9,13-14H,7-8H2 |
| InChIKey | ORZFWIREBJMAHH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-naphthalen-2-yl-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-naphthalen-2-yl-1,2-oxazolidine?
The IUPAC name of 3-naphthalen-2-yl-1,2-oxazolidine (CID 164533749) is 3-naphthalen-2-yl-1,2-oxazolidine.
What is the SMILES notation for 3-naphthalen-2-yl-1,2-oxazolidine?
The canonical SMILES for 3-naphthalen-2-yl-1,2-oxazolidine is c1ccc2cc(C3CCON3)ccc2c1.
What is the InChIKey of 3-naphthalen-2-yl-1,2-oxazolidine?
The InChIKey is ORZFWIREBJMAHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO/c1-2-4-11-9-12(6-5-10(11)3-1)13-7-8-15-14-13/h1-6,9,13-14H,7-8H2.
What are the key properties of 3-naphthalen-2-yl-1,2-oxazolidine?
3-naphthalen-2-yl-1,2-oxazolidine has a molecular weight of 199.25 g/mol, XLogP of 2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-naphthalen-2-yl-1,2-oxazolidine is sourced from PubChem (CID 164533749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).