C32H40N4 — CID 98534445
(5R,7R,12S,14S)-5,14-dimethyl-7,12-dinaphthalen-2-yl-1,4,8,11-tetrazacyclotetradecane (PubChem CID 98534445) has the molecular formula C32H40N4 and a molecular weight of 480.70 g/mol. Its IUPAC name is (5R,7R,12S,14S)-5,14-dimethyl-7,12-dinaphthalen-2-yl-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | (5R,7R,12S,14S)-5,14-dimethyl-7,12-dinaphthalen-2-yl-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 98534445 |
| Molecular Formula | C32H40N4 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | (5R,7R,12S,14S)-5,14-dimethyl-7,12-dinaphthalen-2-yl-1,4,8,11-tetrazacyclotetradecane |
| SMILES | C[C@@H]1C[C@H](c2ccc3ccccc3c2)NCCN[C@H](c2ccc3ccccc3c2)C[C@H](C)NCCN1 |
| InChI | InChI=1S/C32H40N4/c1-23-19-31(29-13-11-25-7-3-5-9-27(25)21-29)35-17-18-36-32(20-24(2)34-16-15-33-23)30-14-12-26-8-4-6-10-28(26)22-30/h3-14,21-24,31-36H,15-20H2,1-2H3/t23-,24+,31-,32+ |
| InChIKey | RJXXRYZDGHULIV-LOWUIPEASA-N |
| XLogP | 5.70 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |