C24H22N2 — CID 11175156
(2S,3S)-2,3-dinaphthalen-2-ylpiperazine (PubChem CID 11175156) has the molecular formula C24H22N2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (2S,3S)-2,3-dinaphthalen-2-ylpiperazine.
| Compound Name | (2S,3S)-2,3-dinaphthalen-2-ylpiperazine |
|---|---|
| PubChem CID | 11175156 |
| Molecular Formula | C24H22N2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (2S,3S)-2,3-dinaphthalen-2-ylpiperazine |
| SMILES | c1ccc2cc([C@@H]3NCCN[C@H]3c3ccc4ccccc4c3)ccc2c1 |
| InChI | InChI=1S/C24H22N2/c1-3-7-19-15-21(11-9-17(19)5-1)23-24(26-14-13-25-23)22-12-10-18-6-2-4-8-20(18)16-22/h1-12,15-16,23-26H,13-14H2/t23-,24-/m0/s1 |
| InChIKey | ZYYPVZKALICCNQ-ZEQRLZLVSA-N |
| XLogP | 4.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |