C22H18N2O2S — CID 139265408
3,4-dinaphthalen-2-yl-1,2,5-thiadiazolidine 1,1-dioxide (PubChem CID 139265408) has the molecular formula C22H18N2O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is 3,4-dinaphthalen-2-yl-1,2,5-thiadiazolidine 1,1-dioxide.
| Compound Name | 3,4-dinaphthalen-2-yl-1,2,5-thiadiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 139265408 |
| Molecular Formula | C22H18N2O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 3,4-dinaphthalen-2-yl-1,2,5-thiadiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)NC(c2ccc3ccccc3c2)C(c2ccc3ccccc3c2)N1 |
| InChI | InChI=1S/C22H18N2O2S/c25-27(26)23-21(19-11-9-15-5-1-3-7-17(15)13-19)22(24-27)20-12-10-16-6-2-4-8-18(16)14-20/h1-14,21-24H |
| InChIKey | CLXODLXWGCMGKI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |