C14H11NO2 — CID 102081693
3-naphthalen-2-ylpyrrolidine-2,5-dione (PubChem CID 102081693) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-naphthalen-2-ylpyrrolidine-2,5-dione.
| Compound Name | 3-naphthalen-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 102081693 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3-naphthalen-2-ylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(c2ccc3ccccc3c2)C(=O)N1 |
| InChI | InChI=1S/C14H11NO2/c16-13-8-12(14(17)15-13)11-6-5-9-3-1-2-4-10(9)7-11/h1-7,12H,8H2,(H,15,16,17) |
| InChIKey | VGPKCEGZCPJDEF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|