C11H11BBr3NO3 — CID 157349957
3-(3-methoxyphenyl)pyrrolidine-2,5-dione;tribromoborane (PubChem CID 157349957) has the molecular formula C11H11BBr3NO3 and a molecular weight of 455.74 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)pyrrolidine-2,5-dione;tribromoborane.
| Compound Name | 3-(3-methoxyphenyl)pyrrolidine-2,5-dione;tribromoborane |
|---|---|
| PubChem CID | 157349957 |
| Molecular Formula | C11H11BBr3NO3 |
| Molecular Weight | 455.74 g/mol |
| Exact Mass | 452.84 |
| IUPAC Name | 3-(3-methoxyphenyl)pyrrolidine-2,5-dione;tribromoborane |
| SMILES | BrB(Br)Br.COc1cccc(C2CC(=O)NC2=O)c1 |
| InChI | InChI=1S/C11H11NO3.BBr3/c1-15-8-4-2-3-7(5-8)9-6-10(13)12-11(9)14;2-1(3)4/h2-5,9H,6H2,1H3,(H,12,13,14); |
| InChIKey | BHKJFNRSFUJZAK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.74 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|