C12H15NO2 — CID 91585654
ethane;(3R)-3-phenylpyrrolidine-2,5-dione (PubChem CID 91585654) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is ethane;(3R)-3-phenylpyrrolidine-2,5-dione.
| Compound Name | ethane;(3R)-3-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 91585654 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | ethane;(3R)-3-phenylpyrrolidine-2,5-dione |
| SMILES | CC.O=C1C[C@H](c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C10H9NO2.C2H6/c12-9-6-8(10(13)11-9)7-4-2-1-3-5-7;1-2/h1-5,8H,6H2,(H,11,12,13);1-2H3/t8-;/m1./s1 |
| InChIKey | PPCPRNIZLSRAKZ-DDWIOCJRSA-N |
| XLogP | 1.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|