C28H28N2O2 — CID 71759600
(3S,7R,9Z,12R)-3,7,12-triphenyl-1,6-diazacyclododec-9-ene-2,5-dione (PubChem CID 71759600) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is (3S,7R,9Z,12R)-3,7,12-triphenyl-1,6-diazacyclododec-9-ene-2,5-dione.
| Compound Name | (3S,7R,9Z,12R)-3,7,12-triphenyl-1,6-diazacyclododec-9-ene-2,5-dione |
|---|---|
| PubChem CID | 71759600 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (3S,7R,9Z,12R)-3,7,12-triphenyl-1,6-diazacyclododec-9-ene-2,5-dione |
| SMILES | O=C1C[C@@H](c2ccccc2)C(=O)N[C@@H](c2ccccc2)C/C=C\C[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C28H28N2O2/c31-27-20-24(21-12-4-1-5-13-21)28(32)30-26(23-16-8-3-9-17-23)19-11-10-18-25(29-27)22-14-6-2-7-15-22/h1-17,24-26H,18-20H2,(H,29,31)(H,30,32)/b11-10-/t24-,25+,26+/m0/s1 |
| InChIKey | GPBYDCUKLUJVJM-RVRXMZCVSA-N |
| XLogP | 5.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|