C16H19NO4 — CID 123762242
(11R)-11-hydroxy-3-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione (PubChem CID 123762242) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (11R)-11-hydroxy-3-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione.
| Compound Name | (11R)-11-hydroxy-3-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
|---|---|
| PubChem CID | 123762242 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (11R)-11-hydroxy-3-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
| SMILES | O=C1CCC=CC[C@@H](O)C(=O)OCC(c2ccccc2)N1 |
| InChI | InChI=1S/C16H19NO4/c18-14-9-5-2-6-10-15(19)17-13(11-21-16(14)20)12-7-3-1-4-8-12/h1-5,7-8,13-14,18H,6,9-11H2,(H,17,19)/t13?,14-/m1/s1 |
| InChIKey | JNDBRNJRGGDVPZ-ARLHGKGLSA-N |
| XLogP | 1.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|