C18H21NO3 — CID 123974172
(8R,12S)-8-methyl-12-phenyl-1-azacyclododec-5-ene-2,9,10-trione (PubChem CID 123974172) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (8R,12S)-8-methyl-12-phenyl-1-azacyclododec-5-ene-2,9,10-trione.
| Compound Name | (8R,12S)-8-methyl-12-phenyl-1-azacyclododec-5-ene-2,9,10-trione |
|---|---|
| PubChem CID | 123974172 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (8R,12S)-8-methyl-12-phenyl-1-azacyclododec-5-ene-2,9,10-trione |
| SMILES | C[C@@H]1CC=CCCC(=O)N[C@H](c2ccccc2)CC(=O)C1=O |
| InChI | InChI=1S/C18H21NO3/c1-13-8-4-2-7-11-17(21)19-15(12-16(20)18(13)22)14-9-5-3-6-10-14/h2-6,9-10,13,15H,7-8,11-12H2,1H3,(H,19,21)/t13-,15+/m1/s1 |
| InChIKey | WXPPCEORSATGIJ-HIFRSBDPSA-N |
| XLogP | 2.75 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|