C11H13NO — CID 124706826
(5R)-5-(2-methylphenyl)pyrrolidin-2-one (PubChem CID 124706826) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is (5R)-5-(2-methylphenyl)pyrrolidin-2-one.
| Compound Name | (5R)-5-(2-methylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 124706826 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (5R)-5-(2-methylphenyl)pyrrolidin-2-one |
| SMILES | Cc1ccccc1[C@H]1CCC(=O)N1 |
| InChI | InChI=1S/C11H13NO/c1-8-4-2-3-5-9(8)10-6-7-11(13)12-10/h2-5,10H,6-7H2,1H3,(H,12,13)/t10-/m1/s1 |
| InChIKey | TWHSDYRKQLDXAD-SNVBAGLBSA-N |
| XLogP | 1.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |