C13H17NO — CID 123290558
6-methyl-5-(2-methylphenyl)piperidin-2-one (PubChem CID 123290558) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 6-methyl-5-(2-methylphenyl)piperidin-2-one.
| Compound Name | 6-methyl-5-(2-methylphenyl)piperidin-2-one |
|---|---|
| PubChem CID | 123290558 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 6-methyl-5-(2-methylphenyl)piperidin-2-one |
| SMILES | Cc1ccccc1C1CCC(=O)NC1C |
| InChI | InChI=1S/C13H17NO/c1-9-5-3-4-6-11(9)12-7-8-13(15)14-10(12)2/h3-6,10,12H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | RYFLLTUMBLXWSA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |