C13H15NO — CID 10750589
(4aR,10bR)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-3-one (PubChem CID 10750589) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is (4aR,10bR)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-3-one.
| Compound Name | (4aR,10bR)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 10750589 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (4aR,10bR)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-3-one |
| SMILES | O=C1CC[C@@H]2c3ccccc3CC[C@H]2N1 |
| InChI | InChI=1S/C13H15NO/c15-13-8-6-11-10-4-2-1-3-9(10)5-7-12(11)14-13/h1-4,11-12H,5-8H2,(H,14,15)/t11-,12-/m1/s1 |
| InChIKey | BLWLGMNKDFKUHA-VXGBXAGGSA-N |
| XLogP | 2.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |