C12H13NO — CID 10997766
(3aS,9bR)-1,3,3a,4,5,9b-hexahydrobenzo[g]indol-2-one (PubChem CID 10997766) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is (3aS,9bR)-1,3,3a,4,5,9b-hexahydrobenzo[g]indol-2-one.
| Compound Name | (3aS,9bR)-1,3,3a,4,5,9b-hexahydrobenzo[g]indol-2-one |
|---|---|
| PubChem CID | 10997766 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | (3aS,9bR)-1,3,3a,4,5,9b-hexahydrobenzo[g]indol-2-one |
| SMILES | O=C1C[C@@H]2CCc3ccccc3[C@@H]2N1 |
| InChI | InChI=1S/C12H13NO/c14-11-7-9-6-5-8-3-1-2-4-10(8)12(9)13-11/h1-4,9,12H,5-7H2,(H,13,14)/t9-,12+/m0/s1 |
| InChIKey | MTLODVAWONZTBL-JOYOIKCWSA-N |
| XLogP | 1.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |