C11H9NO2 — CID 132988443
1,3,3a,8b-tetrahydroindeno[1,2-b]pyrrole-2,4-dione (PubChem CID 132988443) has the molecular formula C11H9NO2 and a molecular weight of 187.20 g/mol. Its IUPAC name is 1,3,3a,8b-tetrahydroindeno[1,2-b]pyrrole-2,4-dione.
| Compound Name | 1,3,3a,8b-tetrahydroindeno[1,2-b]pyrrole-2,4-dione |
|---|---|
| PubChem CID | 132988443 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 1,3,3a,8b-tetrahydroindeno[1,2-b]pyrrole-2,4-dione |
| SMILES | O=C1CC2C(=O)c3ccccc3C2N1 |
| InChI | InChI=1S/C11H9NO2/c13-9-5-8-10(12-9)6-3-1-2-4-7(6)11(8)14/h1-4,8,10H,5H2,(H,12,13) |
| InChIKey | UWZCOBUXSFBXOQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |