C14H12O3 — CID 123667942
4,4a,9,9a-tetrahydro-3H-anthracene-1,2,10-trione (PubChem CID 123667942) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 4,4a,9,9a-tetrahydro-3H-anthracene-1,2,10-trione.
| Compound Name | 4,4a,9,9a-tetrahydro-3H-anthracene-1,2,10-trione |
|---|---|
| PubChem CID | 123667942 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 4,4a,9,9a-tetrahydro-3H-anthracene-1,2,10-trione |
| SMILES | O=C1CCC2C(=O)c3ccccc3CC2C1=O |
| InChI | InChI=1S/C14H12O3/c15-12-6-5-10-11(14(12)17)7-8-3-1-2-4-9(8)13(10)16/h1-4,10-11H,5-7H2 |
| InChIKey | DSIIFOZJLDWCBH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|