C17H19NO4 — CID 144947853
3-(1,3-dioxo-4H-naphthalen-2-yl)piperidine-2,6-dione;ethane (PubChem CID 144947853) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is 3-(1,3-dioxo-4H-naphthalen-2-yl)piperidine-2,6-dione;ethane.
| Compound Name | 3-(1,3-dioxo-4H-naphthalen-2-yl)piperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 144947853 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 3-(1,3-dioxo-4H-naphthalen-2-yl)piperidine-2,6-dione;ethane |
| SMILES | CC.O=C1CCC(C2C(=O)Cc3ccccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C15H13NO4.C2H6/c17-11-7-8-3-1-2-4-9(8)14(19)13(11)10-5-6-12(18)16-15(10)20;1-2/h1-4,10,13H,5-7H2,(H,16,18,20);1-2H3 |
| InChIKey | XLROUAHWNFXFOM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|