C25H32N4O4 — CID 172516805
3-[4-[4-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]-1,3-dioxoinden-2-yl]piperidine-2,6-dione (PubChem CID 172516805) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 3-[4-[4-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]-1,3-dioxoinden-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]-1,3-dioxoinden-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172516805 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 3-[4-[4-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]-1,3-dioxoinden-2-yl]piperidine-2,6-dione |
| SMILES | CN1CCN(CC2CCN(c3cccc4c3C(=O)C(C3CCC(=O)NC3=O)C4=O)CC2)CC1 |
| InChI | InChI=1S/C25H32N4O4/c1-27-11-13-28(14-12-27)15-16-7-9-29(10-8-16)19-4-2-3-17-21(19)24(32)22(23(17)31)18-5-6-20(30)26-25(18)33/h2-4,16,18,22H,5-15H2,1H3,(H,26,30,33) |
| InChIKey | ZKIAJSUYVFJGEV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|