C15H13NO4 — CID 166872046
3-(4-methyl-1,3-dioxoinden-2-yl)piperidine-2,6-dione (PubChem CID 166872046) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 3-(4-methyl-1,3-dioxoinden-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-methyl-1,3-dioxoinden-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 166872046 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-(4-methyl-1,3-dioxoinden-2-yl)piperidine-2,6-dione |
| SMILES | Cc1cccc2c1C(=O)C(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C15H13NO4/c1-7-3-2-4-8-11(7)14(19)12(13(8)18)9-5-6-10(17)16-15(9)20/h2-4,9,12H,5-6H2,1H3,(H,16,17,20) |
| InChIKey | ULOZLAQHUAYWKU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|