C11H8O3 — CID 121222541
3-methyl-1a,7a-dihydronaphtho[2,3-b]oxirene-2,7-dione (PubChem CID 121222541) has the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. Its IUPAC name is 3-methyl-1a,7a-dihydronaphtho[2,3-b]oxirene-2,7-dione.
| Compound Name | 3-methyl-1a,7a-dihydronaphtho[2,3-b]oxirene-2,7-dione |
|---|---|
| PubChem CID | 121222541 |
| Molecular Formula | C11H8O3 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 3-methyl-1a,7a-dihydronaphtho[2,3-b]oxirene-2,7-dione |
| SMILES | Cc1cccc2c1C(=O)C1OC1C2=O |
| InChI | InChI=1S/C11H8O3/c1-5-3-2-4-6-7(5)9(13)11-10(14-11)8(6)12/h2-4,10-11H,1H3 |
| InChIKey | NDBUGIXCMJWKNN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|