C18H18O2 — CID 54539649
1,7-dimethylphenanthrene-9,10-dione;ethane (PubChem CID 54539649) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1,7-dimethylphenanthrene-9,10-dione;ethane.
| Compound Name | 1,7-dimethylphenanthrene-9,10-dione;ethane |
|---|---|
| PubChem CID | 54539649 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1,7-dimethylphenanthrene-9,10-dione;ethane |
| SMILES | CC.Cc1ccc2c(c1)C(=O)C(=O)c1c(C)cccc1-2 |
| InChI | InChI=1S/C16H12O2.C2H6/c1-9-6-7-11-12-5-3-4-10(2)14(12)16(18)15(17)13(11)8-9;1-2/h3-8H,1-2H3;1-2H3 |
| InChIKey | ZCGCVLUOERKYRU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|