C22H28O3 — CID 142508959
1,7-dimethylfluoren-9-one;3-methoxy-2,3-dimethylbutan-2-ol (PubChem CID 142508959) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 1,7-dimethylfluoren-9-one;3-methoxy-2,3-dimethylbutan-2-ol.
| Compound Name | 1,7-dimethylfluoren-9-one;3-methoxy-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 142508959 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1,7-dimethylfluoren-9-one;3-methoxy-2,3-dimethylbutan-2-ol |
| SMILES | COC(C)(C)C(C)(C)O.Cc1ccc2c(c1)C(=O)c1c(C)cccc1-2 |
| InChI | InChI=1S/C15H12O.C7H16O2/c1-9-6-7-11-12-5-3-4-10(2)14(12)15(16)13(11)8-9;1-6(2,8)7(3,4)9-5/h3-8H,1-2H3;8H,1-5H3 |
| InChIKey | LEVKHYDRVHVAJV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |