C16H12O4 — CID 102313508
1,4-dihydroxy-2,7-dimethylanthracene-9,10-dione (PubChem CID 102313508) has the molecular formula C16H12O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 1,4-dihydroxy-2,7-dimethylanthracene-9,10-dione.
| Compound Name | 1,4-dihydroxy-2,7-dimethylanthracene-9,10-dione |
|---|---|
| PubChem CID | 102313508 |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1,4-dihydroxy-2,7-dimethylanthracene-9,10-dione |
| SMILES | Cc1ccc2c(c1)C(=O)c1c(O)c(C)cc(O)c1C2=O |
| InChI | InChI=1S/C16H12O4/c1-7-3-4-9-10(5-7)16(20)13-12(15(9)19)11(17)6-8(2)14(13)18/h3-6,17-18H,1-2H3 |
| InChIKey | AGBYZOMQFDBMRL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|