C28H16O9 — CID 87387452
1,2-dihydroxyanthracene-9,10-dione;1,2,4-trihydroxyanthracene-9,10-dione (PubChem CID 87387452) has the molecular formula C28H16O9 and a molecular weight of 496.43 g/mol. Its IUPAC name is 1,2-dihydroxyanthracene-9,10-dione;1,2,4-trihydroxyanthracene-9,10-dione.
| Compound Name | 1,2-dihydroxyanthracene-9,10-dione;1,2,4-trihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 87387452 |
| Molecular Formula | C28H16O9 |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 1,2-dihydroxyanthracene-9,10-dione;1,2,4-trihydroxyanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(O)cc(O)c21.O=C1c2ccccc2C(=O)c2c1ccc(O)c2O |
| InChI | InChI=1S/C14H8O5.C14H8O4/c15-8-5-9(16)14(19)11-10(8)12(17)6-3-1-2-4-7(6)13(11)18;15-10-6-5-9-11(14(10)18)13(17)8-4-2-1-3-7(8)12(9)16/h1-5,15-16,19H;1-6,15,18H |
| InChIKey | PZKIISKYGSMSCT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|