C14H8AlO7S — CID 174211187
CID 174211187 (PubChem CID 174211187) has the molecular formula C14H8AlO7S and a molecular weight of 347.26 g/mol.
| Compound Name | CID 174211187 |
|---|---|
| PubChem CID | 174211187 |
| Molecular Formula | C14H8AlO7S |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | — |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(S(=O)(=O)O)cc(O)c21.[Al] |
| InChI | InChI=1S/C14H8O7S.Al/c15-8-5-9(22(19,20)21)14(18)11-10(8)12(16)6-3-1-2-4-7(6)13(11)17;/h1-5,15,18H,(H,19,20,21); |
| InChIKey | LJRVZHUNPWWOHE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|