C22H25NO4 — CID 12678915
1,4-dihydroxy-2-(octylamino)anthracene-9,10-dione (PubChem CID 12678915) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1,4-dihydroxy-2-(octylamino)anthracene-9,10-dione.
| Compound Name | 1,4-dihydroxy-2-(octylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 12678915 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 1,4-dihydroxy-2-(octylamino)anthracene-9,10-dione |
| SMILES | CCCCCCCCNc1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H25NO4/c1-2-3-4-5-6-9-12-23-16-13-17(24)18-19(22(16)27)21(26)15-11-8-7-10-14(15)20(18)25/h7-8,10-11,13,23-24,27H,2-6,9,12H2,1H3 |
| InChIKey | KSXIWONMMYSQNX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|