C18H22BrNO2 — CID 171665818
2-bromo-3-(octylamino)naphthalene-1,4-dione (PubChem CID 171665818) has the molecular formula C18H22BrNO2 and a molecular weight of 364.28 g/mol. Its IUPAC name is 2-bromo-3-(octylamino)naphthalene-1,4-dione.
| Compound Name | 2-bromo-3-(octylamino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 171665818 |
| Molecular Formula | C18H22BrNO2 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-bromo-3-(octylamino)naphthalene-1,4-dione |
| SMILES | CCCCCCCCNC1=C(Br)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H22BrNO2/c1-2-3-4-5-6-9-12-20-16-15(19)17(21)13-10-7-8-11-14(13)18(16)22/h7-8,10-11,20H,2-6,9,12H2,1H3 |
| InChIKey | RKKGYVAKOOMUOE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|