C19H18N2O4 — CID 70630487
2-nitro-1-(pentylamino)anthracene-9,10-dione (PubChem CID 70630487) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-nitro-1-(pentylamino)anthracene-9,10-dione.
| Compound Name | 2-nitro-1-(pentylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 70630487 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-nitro-1-(pentylamino)anthracene-9,10-dione |
| SMILES | CCCCCNc1c([N+](=O)[O-])ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H18N2O4/c1-2-3-6-11-20-17-15(21(24)25)10-9-14-16(17)19(23)13-8-5-4-7-12(13)18(14)22/h4-5,7-10,20H,2-3,6,11H2,1H3 |
| InChIKey | BXKCXQUNXWXQJD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|