C39H40N4O4 — CID 140546332
1-[2-(dimethylamino)ethylamino]-2-[3-[1-[2-(dimethylamino)ethylamino]-9,10-dioxoanthracen-2-yl]propyl]anthracene-9,10-dione (PubChem CID 140546332) has the molecular formula C39H40N4O4 and a molecular weight of 628.77 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethylamino]-2-[3-[1-[2-(dimethylamino)ethylamino]-9,10-dioxoanthracen-2-yl]propyl]anthracene-9,10-dione.
| Compound Name | 1-[2-(dimethylamino)ethylamino]-2-[3-[1-[2-(dimethylamino)ethylamino]-9,10-dioxoanthracen-2-yl]propyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 140546332 |
| Molecular Formula | C39H40N4O4 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | 1-[2-(dimethylamino)ethylamino]-2-[3-[1-[2-(dimethylamino)ethylamino]-9,10-dioxoanthracen-2-yl]propyl]anthracene-9,10-dione |
| SMILES | CN(C)CCNc1c(CCCc2ccc3c(c2NCCN(C)C)C(=O)c2ccccc2C3=O)ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C39H40N4O4/c1-42(2)22-20-40-34-24(16-18-30-32(34)38(46)28-14-7-5-12-26(28)36(30)44)10-9-11-25-17-19-31-33(35(25)41-21-23-43(3)4)39(47)29-15-8-6-13-27(29)37(31)45/h5-8,12-19,40-41H,9-11,20-23H2,1-4H3 |
| InChIKey | VZGZCSOLHHIIPO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|