C17H15ClN2O2 — CID 140996904
1-(3-aminopropylamino)-2-chloroanthracene-9,10-dione (PubChem CID 140996904) has the molecular formula C17H15ClN2O2 and a molecular weight of 314.77 g/mol. Its IUPAC name is 1-(3-aminopropylamino)-2-chloroanthracene-9,10-dione.
| Compound Name | 1-(3-aminopropylamino)-2-chloroanthracene-9,10-dione |
|---|---|
| PubChem CID | 140996904 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-(3-aminopropylamino)-2-chloroanthracene-9,10-dione |
| SMILES | NCCCNc1c(Cl)ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H15ClN2O2/c18-13-7-6-12-14(15(13)20-9-3-8-19)17(22)11-5-2-1-4-10(11)16(12)21/h1-2,4-7,20H,3,8-9,19H2 |
| InChIKey | IIYIKSFLUFMBTN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|