C21H25N3O3 — CID 71475397
1-[[3-(4-aminobutylamino)-2-hydroxypropyl]amino]anthracene-9,10-dione (PubChem CID 71475397) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-[[3-(4-aminobutylamino)-2-hydroxypropyl]amino]anthracene-9,10-dione.
| Compound Name | 1-[[3-(4-aminobutylamino)-2-hydroxypropyl]amino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 71475397 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-[[3-(4-aminobutylamino)-2-hydroxypropyl]amino]anthracene-9,10-dione |
| SMILES | NCCCCNCC(O)CNc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H25N3O3/c22-10-3-4-11-23-12-14(25)13-24-18-9-5-8-17-19(18)21(27)16-7-2-1-6-15(16)20(17)26/h1-2,5-9,14,23-25H,3-4,10-13,22H2 |
| InChIKey | LOVAHQGXMVQYEN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|