C20H21N3O3 — CID 90644039
2-(4-aminobutylamino)-N-(9,10-dioxoanthracen-1-yl)acetamide (PubChem CID 90644039) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-(4-aminobutylamino)-N-(9,10-dioxoanthracen-1-yl)acetamide.
| Compound Name | 2-(4-aminobutylamino)-N-(9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 90644039 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-(4-aminobutylamino)-N-(9,10-dioxoanthracen-1-yl)acetamide |
| SMILES | NCCCCNCC(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H21N3O3/c21-10-3-4-11-22-12-17(24)23-16-9-5-8-15-18(16)20(26)14-7-2-1-6-13(14)19(15)25/h1-2,5-9,22H,3-4,10-12,21H2,(H,23,24) |
| InChIKey | PXALSDREKLBDRS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|