C22H24N4O4 — CID 102155792
4-amino-N-[5-(4-aminobutanoylamino)-9,10-dioxoanthracen-1-yl]butanamide (PubChem CID 102155792) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 4-amino-N-[5-(4-aminobutanoylamino)-9,10-dioxoanthracen-1-yl]butanamide.
| Compound Name | 4-amino-N-[5-(4-aminobutanoylamino)-9,10-dioxoanthracen-1-yl]butanamide |
|---|---|
| PubChem CID | 102155792 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 4-amino-N-[5-(4-aminobutanoylamino)-9,10-dioxoanthracen-1-yl]butanamide |
| SMILES | NCCCC(=O)Nc1cccc2c1C(=O)c1cccc(NC(=O)CCCN)c1C2=O |
| InChI | InChI=1S/C22H24N4O4/c23-11-3-9-17(27)25-15-7-1-5-13-19(15)22(30)14-6-2-8-16(20(14)21(13)29)26-18(28)10-4-12-24/h1-2,5-8H,3-4,9-12,23-24H2,(H,25,27)(H,26,28) |
| InChIKey | BTQOQJXLODIITF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|