C20H18BrNO3 — CID 44614049
6-bromo-N-(9,10-dioxoanthracen-1-yl)hexanamide (PubChem CID 44614049) has the molecular formula C20H18BrNO3 and a molecular weight of 400.27 g/mol. Its IUPAC name is 6-bromo-N-(9,10-dioxoanthracen-1-yl)hexanamide.
| Compound Name | 6-bromo-N-(9,10-dioxoanthracen-1-yl)hexanamide |
|---|---|
| PubChem CID | 44614049 |
| Molecular Formula | C20H18BrNO3 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 6-bromo-N-(9,10-dioxoanthracen-1-yl)hexanamide |
| SMILES | O=C(CCCCCBr)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H18BrNO3/c21-12-5-1-2-11-17(23)22-16-10-6-9-15-18(16)20(25)14-8-4-3-7-13(14)19(15)24/h3-4,6-10H,1-2,5,11-12H2,(H,22,23) |
| InChIKey | DUGLXGCCGWAEDL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|