C18H17N2O4+ — CID 7343695
[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium (PubChem CID 7343695) has the molecular formula C18H17N2O4+ and a molecular weight of 325.34 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium.
| Compound Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 7343695 |
| Molecular Formula | C18H17N2O4+ |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium |
| SMILES | O=C(C[NH2+]CCO)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H16N2O4/c21-9-8-19-10-15(22)20-14-7-3-6-13-16(14)18(24)12-5-2-1-4-11(12)17(13)23/h1-7,19,21H,8-10H2,(H,20,22)/p+1 |
| InChIKey | UNMADWIGEWDKJT-UHFFFAOYSA-O |
| XLogP | -0.04 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|