About [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium
[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium (PubChem CID 7343695) has the molecular formula C18H17N2O4+
and a molecular weight of 325.34 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium.
Molecular Properties
| Compound Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium |
| PubChem CID | 7343695 |
| Molecular Formula | C18H17N2O4+ |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium |
| SMILES | O=C(C[NH2+]CCO)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H16N2O4/c21-9-8-19-10-15(22)20-14-7-3-6-13-16(14)18(24)12-5-2-1-4-11(12)17(13)23/h1-7,19,21H,8-10H2,(H,20,22)/p+1 |
| InChIKey | UNMADWIGEWDKJT-UHFFFAOYSA-O |
| XLogP | -0.04 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium?
The IUPAC name of [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium (CID 7343695) is [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium.
What is the SMILES notation for [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium?
The canonical SMILES for [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium is O=C(C[NH2+]CCO)Nc1cccc2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium?
The InChIKey is UNMADWIGEWDKJT-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H16N2O4/c21-9-8-19-10-15(22)20-14-7-3-6-13-16(14)18(24)12-5-2-1-4-11(12)17(13)23/h1-7,19,21H,8-10H2,(H,20,22)/p+1.
What are the key properties of [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium?
[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium has a molecular weight of 325.34 g/mol, XLogP of -0.04, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]-(2-hydroxyethyl)azanium is sourced from PubChem (CID 7343695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).