C22H24N2O3 — CID 34599401
N-(9,10-dioxoanthracen-1-yl)-2-(dipropylamino)acetamide (PubChem CID 34599401) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-2-(dipropylamino)acetamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-2-(dipropylamino)acetamide |
|---|---|
| PubChem CID | 34599401 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-2-(dipropylamino)acetamide |
| SMILES | CCCN(CCC)CC(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H24N2O3/c1-3-12-24(13-4-2)14-19(25)23-18-11-7-10-17-20(18)22(27)16-9-6-5-8-15(16)21(17)26/h5-11H,3-4,12-14H2,1-2H3,(H,23,25) |
| InChIKey | YKSRPTFXBNICOF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|