C24H19ClN2O3 — CID 9057937
2-[(2-chlorophenyl)methyl-methylamino]-N-(9,10-dioxoanthracen-1-yl)acetamide (PubChem CID 9057937) has the molecular formula C24H19ClN2O3 and a molecular weight of 418.88 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-methylamino]-N-(9,10-dioxoanthracen-1-yl)acetamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-(9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 9057937 |
| Molecular Formula | C24H19ClN2O3 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-(9,10-dioxoanthracen-1-yl)acetamide |
| SMILES | CN(CC(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C24H19ClN2O3/c1-27(13-15-7-2-5-11-19(15)25)14-21(28)26-20-12-6-10-18-22(20)24(30)17-9-4-3-8-16(17)23(18)29/h2-12H,13-14H2,1H3,(H,26,28) |
| InChIKey | KRJXFWRVCLSOLH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|