C16H13Cl5N2O — CID 18282633
2-[(2-chlorophenyl)methyl-methylamino]-N-(2,3,5,6-tetrachlorophenyl)acetamide (PubChem CID 18282633) has the molecular formula C16H13Cl5N2O and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-methylamino]-N-(2,3,5,6-tetrachlorophenyl)acetamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-(2,3,5,6-tetrachlorophenyl)acetamide |
|---|---|
| PubChem CID | 18282633 |
| Molecular Formula | C16H13Cl5N2O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 423.95 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-(2,3,5,6-tetrachlorophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1c(Cl)c(Cl)cc(Cl)c1Cl)Cc1ccccc1Cl |
| InChI | InChI=1S/C16H13Cl5N2O/c1-23(7-9-4-2-3-5-10(9)17)8-13(24)22-16-14(20)11(18)6-12(19)15(16)21/h2-6H,7-8H2,1H3,(H,22,24) |
| InChIKey | RZCHJZRFPOJHHX-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|