C17H18ClIN2O — CID 27222679
2-[(2-chlorophenyl)methyl-methylamino]-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 27222679) has the molecular formula C17H18ClIN2O and a molecular weight of 428.70 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-methylamino]-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 27222679 |
| Molecular Formula | C17H18ClIN2O |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)CN(C)Cc1ccccc1Cl |
| InChI | InChI=1S/C17H18ClIN2O/c1-12-9-14(19)7-8-16(12)20-17(22)11-21(2)10-13-5-3-4-6-15(13)18/h3-9H,10-11H2,1-2H3,(H,20,22) |
| InChIKey | PCRMHQUKJPRKNB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|