C16H18ClN3O3S — CID 9058026
2-[(2-chlorophenyl)methyl-methylamino]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 9058026) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-methylamino]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 9058026 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(S(N)(=O)=O)cc1)Cc1ccccc1Cl |
| InChI | InChI=1S/C16H18ClN3O3S/c1-20(10-12-4-2-3-5-15(12)17)11-16(21)19-13-6-8-14(9-7-13)24(18,22)23/h2-9H,10-11H2,1H3,(H,19,21)(H2,18,22,23) |
| InChIKey | UBXVCIJTRZSZGR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |