C17H19Cl2N3O3S — CID 24681104
3-[(2,4-dichlorophenyl)methyl-methylamino]-N-(4-sulfamoylphenyl)propanamide (PubChem CID 24681104) has the molecular formula C17H19Cl2N3O3S and a molecular weight of 416.33 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methyl-methylamino]-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 3-[(2,4-dichlorophenyl)methyl-methylamino]-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 24681104 |
| Molecular Formula | C17H19Cl2N3O3S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methyl-methylamino]-N-(4-sulfamoylphenyl)propanamide |
| SMILES | CN(CCC(=O)Nc1ccc(S(N)(=O)=O)cc1)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H19Cl2N3O3S/c1-22(11-12-2-3-13(18)10-16(12)19)9-8-17(23)21-14-4-6-15(7-5-14)26(20,24)25/h2-7,10H,8-9,11H2,1H3,(H,21,23)(H2,20,24,25) |
| InChIKey | CKMXBXDKLVDFJO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |