C24H27NO3 — CID 4282760
N-(9,10-dioxoanthracen-1-yl)decanamide (PubChem CID 4282760) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)decanamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)decanamide |
|---|---|
| PubChem CID | 4282760 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H27NO3/c1-2-3-4-5-6-7-8-16-21(26)25-20-15-11-14-19-22(20)24(28)18-13-10-9-12-17(18)23(19)27/h9-15H,2-8,16H2,1H3,(H,25,26) |
| InChIKey | AOUYNBYQVJYOBZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|