C22H22N2O5 — CID 102264049
N'-[2-(9,10-dioxoanthracen-1-yl)oxyacetyl]hexanehydrazide (PubChem CID 102264049) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is N'-[2-(9,10-dioxoanthracen-1-yl)oxyacetyl]hexanehydrazide.
| Compound Name | N'-[2-(9,10-dioxoanthracen-1-yl)oxyacetyl]hexanehydrazide |
|---|---|
| PubChem CID | 102264049 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N'-[2-(9,10-dioxoanthracen-1-yl)oxyacetyl]hexanehydrazide |
| SMILES | CCCCCC(=O)NNC(=O)COc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H22N2O5/c1-2-3-4-12-18(25)23-24-19(26)13-29-17-11-7-10-16-20(17)22(28)15-9-6-5-8-14(15)21(16)27/h5-11H,2-4,12-13H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | AAELLQHOUGMYJK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|