C19H16O3 — CID 86244771
1-(3-methylbut-2-enoxy)anthracene-9,10-dione (PubChem CID 86244771) has the molecular formula C19H16O3 and a molecular weight of 292.33 g/mol. Its IUPAC name is 1-(3-methylbut-2-enoxy)anthracene-9,10-dione.
| Compound Name | 1-(3-methylbut-2-enoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 86244771 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-(3-methylbut-2-enoxy)anthracene-9,10-dione |
| SMILES | CC(C)=CCOc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H16O3/c1-12(2)10-11-22-16-9-5-8-15-17(16)19(21)14-7-4-3-6-13(14)18(15)20/h3-10H,11H2,1-2H3 |
| InChIKey | NEMMSCDYGIZXSE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|